C9H19N3O — CID 157393213
N'-(2-amino-4,4-dimethyl-3-oxopentyl)ethanimidamide (PubChem CID 157393213) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N'-(2-amino-4,4-dimethyl-3-oxopentyl)ethanimidamide.
| Compound Name | N'-(2-amino-4,4-dimethyl-3-oxopentyl)ethanimidamide |
|---|---|
| PubChem CID | 157393213 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N'-(2-amino-4,4-dimethyl-3-oxopentyl)ethanimidamide |
| SMILES | C/C(N)=N\CC(N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C9H19N3O/c1-6(10)12-5-7(11)8(13)9(2,3)4/h7H,5,11H2,1-4H3,(H2,10,12) |
| InChIKey | BMGKTPKAWUWTRV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|