C14H24O2S — CID 10634851
ethyl (1S,2S)-3,4-dimethyl-2-methylsulfanyl-1-propan-2-ylcyclopent-3-ene-1-carboxylate (PubChem CID 10634851) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is ethyl (1S,2S)-3,4-dimethyl-2-methylsulfanyl-1-propan-2-ylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2S)-3,4-dimethyl-2-methylsulfanyl-1-propan-2-ylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10634851 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | ethyl (1S,2S)-3,4-dimethyl-2-methylsulfanyl-1-propan-2-ylcyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(C)C)CC(C)=C(C)[C@@H]1SC |
| InChI | InChI=1S/C14H24O2S/c1-7-16-13(15)14(9(2)3)8-10(4)11(5)12(14)17-6/h9,12H,7-8H2,1-6H3/t12-,14+/m0/s1 |
| InChIKey | COJVCUUGNCDUGU-GXTWGEPZSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|