C11H16ClFN2 — CID 106354222
N-(1-chloro-4-methylpentan-3-yl)-5-fluoropyridin-2-amine (PubChem CID 106354222) has the molecular formula C11H16ClFN2 and a molecular weight of 230.71 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-5-fluoropyridin-2-amine.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-5-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 106354222 |
| Molecular Formula | C11H16ClFN2 |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-5-fluoropyridin-2-amine |
| SMILES | CC(C)C(CCCl)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C11H16ClFN2/c1-8(2)10(5-6-12)15-11-4-3-9(13)7-14-11/h3-4,7-8,10H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | XSLOTFZKAPPLTE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|