C19H28O — CID 10635939
[(2R,3S)-2-methyl-3-[(1S)-1-methylcyclohex-2-en-1-yl]butoxy]methylbenzene (PubChem CID 10635939) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is [(2R,3S)-2-methyl-3-[(1S)-1-methylcyclohex-2-en-1-yl]butoxy]methylbenzene.
| Compound Name | [(2R,3S)-2-methyl-3-[(1S)-1-methylcyclohex-2-en-1-yl]butoxy]methylbenzene |
|---|---|
| PubChem CID | 10635939 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | [(2R,3S)-2-methyl-3-[(1S)-1-methylcyclohex-2-en-1-yl]butoxy]methylbenzene |
| SMILES | C[C@@H](COCc1ccccc1)[C@H](C)[C@]1(C)C=CCCC1 |
| InChI | InChI=1S/C19H28O/c1-16(14-20-15-18-10-6-4-7-11-18)17(2)19(3)12-8-5-9-13-19/h4,6-8,10-12,16-17H,5,9,13-15H2,1-3H3/t16-,17-,19+/m0/s1 |
| InChIKey | KQPWHHSUPBZZPC-JENIJYKNSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|