About [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol
[2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol (PubChem CID 106360126) has the molecular formula C14H19F3N2O
and a molecular weight of 288.31 g/mol. Its IUPAC name is [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol |
| PubChem CID | 106360126 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol |
| SMILES | NCC(NC1CCCC1CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H19F3N2O/c15-10-4-9(5-11(16)14(10)17)13(6-18)19-12-3-1-2-8(12)7-20/h4-5,8,12-13,19-20H,1-3,6-7,18H2 |
| InChIKey | YQRUMKZSTKOSFF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol?
The IUPAC name of [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol (CID 106360126) is [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol.
What is the SMILES notation for [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol?
The canonical SMILES for [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol is NCC(NC1CCCC1CO)c1cc(F)c(F)c(F)c1.
What is the InChIKey of [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol?
The InChIKey is YQRUMKZSTKOSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O/c15-10-4-9(5-11(16)14(10)17)13(6-18)19-12-3-1-2-8(12)7-20/h4-5,8,12-13,19-20H,1-3,6-7,18H2.
What are the key properties of [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol?
[2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol has a molecular weight of 288.31 g/mol, XLogP of 1.85, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-amino-1-(3,4,5-trifluorophenyl)ethyl]amino]cyclopentyl]methanol is sourced from PubChem (CID 106360126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).