About [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol
[2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol (PubChem CID 106360163) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol |
| PubChem CID | 106360163 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol |
| SMILES | Cc1ccc(C)c(C(CN)NC2CCCC2CO)c1 |
| InChI | InChI=1S/C16H26N2O/c1-11-6-7-12(2)14(8-11)16(9-17)18-15-5-3-4-13(15)10-19/h6-8,13,15-16,18-19H,3-5,9-10,17H2,1-2H3 |
| InChIKey | KYBDLHTZLBHYEH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol?
The IUPAC name of [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol (CID 106360163) is [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol.
What is the SMILES notation for [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol?
The canonical SMILES for [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol is Cc1ccc(C)c(C(CN)NC2CCCC2CO)c1.
What is the InChIKey of [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol?
The InChIKey is KYBDLHTZLBHYEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-11-6-7-12(2)14(8-11)16(9-17)18-15-5-3-4-13(15)10-19/h6-8,13,15-16,18-19H,3-5,9-10,17H2,1-2H3.
What are the key properties of [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol?
[2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol has a molecular weight of 262.40 g/mol, XLogP of 2.05, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-amino-1-(2,5-dimethylphenyl)ethyl]amino]cyclopentyl]methanol is sourced from PubChem (CID 106360163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).