About [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol
[2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol (PubChem CID 106360448) has the molecular formula C14H26N4O
and a molecular weight of 266.39 g/mol. Its IUPAC name is [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol |
| PubChem CID | 106360448 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol |
| SMILES | Cc1c(C(CN)NC2CCCCC2CO)cnn1C |
| InChI | InChI=1S/C14H26N4O/c1-10-12(8-16-18(10)2)14(7-15)17-13-6-4-3-5-11(13)9-19/h8,11,13-14,17,19H,3-7,9,15H2,1-2H3 |
| InChIKey | BMQPUMVFMBIRRN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol?
The IUPAC name of [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol (CID 106360448) is [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol.
What is the SMILES notation for [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol?
The canonical SMILES for [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol is Cc1c(C(CN)NC2CCCCC2CO)cnn1C.
What is the InChIKey of [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol?
The InChIKey is BMQPUMVFMBIRRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O/c1-10-12(8-16-18(10)2)14(7-15)17-13-6-4-3-5-11(13)9-19/h8,11,13-14,17,19H,3-7,9,15H2,1-2H3.
What are the key properties of [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol?
[2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol has a molecular weight of 266.39 g/mol, XLogP of 0.87, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-amino-1-(1,5-dimethylpyrazol-4-yl)ethyl]amino]cyclohexyl]methanol is sourced from PubChem (CID 106360448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).