C16H20N2S — CID 106363861
N-(2,3-dihydro-1H-inden-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 106363861) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 106363861 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | c1ccc2c(c1)CC(NC1=NC3CCCC3CS1)C2 |
| InChI | InChI=1S/C16H20N2S/c1-2-5-12-9-14(8-11(12)4-1)17-16-18-15-7-3-6-13(15)10-19-16/h1-2,4-5,13-15H,3,6-10H2,(H,17,18) |
| InChIKey | BYOVPVIYENFGNW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |