C15H27N3S — CID 106362995
N-(1-ethylpiperidin-3-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106362995) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(1-ethylpiperidin-3-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106362995 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | CCN1CCCC(NC2=NC3CCCCC3CS2)C1 |
| InChI | InChI=1S/C15H27N3S/c1-2-18-9-5-7-13(10-18)16-15-17-14-8-4-3-6-12(14)11-19-15/h12-14H,2-11H2,1H3,(H,16,17) |
| InChIKey | TZEQVSJSLWIZEI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |