C15H22O5 — CID 10636617
(1R,4S,5S,6S,8S,9S,12S,13R)-6-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one (PubChem CID 10636617) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1R,4S,5S,6S,8S,9S,12S,13R)-6-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one.
| Compound Name | (1R,4S,5S,6S,8S,9S,12S,13R)-6-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one |
|---|---|
| PubChem CID | 10636617 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1R,4S,5S,6S,8S,9S,12S,13R)-6-hydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one |
| SMILES | C[C@@H]1[C@@H](O)C[C@H]2[C@H](C)C(=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32O4 |
| InChI | InChI=1S/C15H22O5/c1-7-9-4-5-14(3)19-13-15(9,20-14)10(6-11(7)16)8(2)12(17)18-13/h7-11,13,16H,4-6H2,1-3H3/t7-,8-,9-,10-,11-,13+,14-,15+/m0/s1 |
| InChIKey | NGRYWHWRFKHJMI-WZXDADOBSA-N |
| XLogP | 1.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |