C15H22O6 — CID 162980626
(1R,4R,5S,6S,7S,8S,9R,12R,13R)-6,7-dihydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one (PubChem CID 162980626) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1R,4R,5S,6S,7S,8S,9R,12R,13R)-6,7-dihydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one.
| Compound Name | (1R,4R,5S,6S,7S,8S,9R,12R,13R)-6,7-dihydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one |
|---|---|
| PubChem CID | 162980626 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (1R,4R,5S,6S,7S,8S,9R,12R,13R)-6,7-dihydroxy-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one |
| SMILES | C[C@@H]1[C@H](O)[C@@H](O)[C@@H]2[C@@H](C)C(=O)O[C@H]3O[C@]4(C)CC[C@H]1[C@]32O4 |
| InChI | InChI=1S/C15H22O6/c1-6-8-4-5-14(3)20-13-15(8,21-14)9(11(17)10(6)16)7(2)12(18)19-13/h6-11,13,16-17H,4-5H2,1-3H3/t6-,7+,8+,9-,10-,11-,13-,14-,15+/m0/s1 |
| InChIKey | WWENYAIGLJZDJA-JZWWIUQJSA-N |
| XLogP | 0.40 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |