C26H29NO7 — CID 45484311
[(1S,4S,5S,6S,8S,9R,12S,13R)-1,5,9-trimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-yl] N-naphthalen-1-ylcarbamate (PubChem CID 45484311) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is [(1S,4S,5S,6S,8S,9R,12S,13R)-1,5,9-trimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(1S,4S,5S,6S,8S,9R,12S,13R)-1,5,9-trimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 45484311 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [(1S,4S,5S,6S,8S,9R,12S,13R)-1,5,9-trimethyl-10-oxo-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-6-yl] N-naphthalen-1-ylcarbamate |
| SMILES | C[C@@H]1[C@@H](OC(=O)Nc2cccc3ccccc23)C[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C26H29NO7/c1-14-18-11-12-25(3)32-23-26(18,34-33-25)19(15(2)22(28)31-23)13-21(14)30-24(29)27-20-10-6-8-16-7-4-5-9-17(16)20/h4-10,14-15,18-19,21,23H,11-13H2,1-3H3,(H,27,29)/t14-,15+,18-,19-,21-,23+,25-,26+/m0/s1 |
| InChIKey | NZDCEYOTLRSRSG-VUVLSBSRSA-N |
| XLogP | 4.78 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|