C22H25NO5S — CID 11304570
[(3R,6R)-2,2,6-trimethyl-6-[(4S)-2-sulfanylidene-1,3-dioxolan-4-yl]oxan-3-yl] N-naphthalen-1-ylcarbamate (PubChem CID 11304570) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is [(3R,6R)-2,2,6-trimethyl-6-[(4S)-2-sulfanylidene-1,3-dioxolan-4-yl]oxan-3-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(3R,6R)-2,2,6-trimethyl-6-[(4S)-2-sulfanylidene-1,3-dioxolan-4-yl]oxan-3-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 11304570 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [(3R,6R)-2,2,6-trimethyl-6-[(4S)-2-sulfanylidene-1,3-dioxolan-4-yl]oxan-3-yl] N-naphthalen-1-ylcarbamate |
| SMILES | CC1(C)O[C@@](C)([C@@H]2COC(=S)O2)CC[C@H]1OC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H25NO5S/c1-21(2)17(11-12-22(3,28-21)18-13-25-20(29)27-18)26-19(24)23-16-10-6-8-14-7-4-5-9-15(14)16/h4-10,17-18H,11-13H2,1-3H3,(H,23,24)/t17-,18+,22-/m1/s1 |
| InChIKey | NSODRSPRDHOTGA-KGVIQGDOSA-N |
| XLogP | 4.80 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|