C11H18BrF2NO2 — CID 106366258
N-[2-(bromomethyl)cyclopentyl]-3-(2,2-difluoroethoxy)propanamide (PubChem CID 106366258) has the molecular formula C11H18BrF2NO2 and a molecular weight of 314.17 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 106366258 |
| Molecular Formula | C11H18BrF2NO2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-3-(2,2-difluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)F)NC1CCCC1CBr |
| InChI | InChI=1S/C11H18BrF2NO2/c12-6-8-2-1-3-9(8)15-11(16)4-5-17-7-10(13)14/h8-10H,1-7H2,(H,15,16) |
| InChIKey | VHLLNZOMOJXXHK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|