C12H20BrF2NO2 — CID 106367115
N-[2-(bromomethyl)cyclohexyl]-3-(2,2-difluoroethoxy)propanamide (PubChem CID 106367115) has the molecular formula C12H20BrF2NO2 and a molecular weight of 328.20 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclohexyl]-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-[2-(bromomethyl)cyclohexyl]-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 106367115 |
| Molecular Formula | C12H20BrF2NO2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[2-(bromomethyl)cyclohexyl]-3-(2,2-difluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)F)NC1CCCCC1CBr |
| InChI | InChI=1S/C12H20BrF2NO2/c13-7-9-3-1-2-4-10(9)16-12(17)5-6-18-8-11(14)15/h9-11H,1-8H2,(H,16,17) |
| InChIKey | SFSCCDYJXUJKFU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|