C10H14BrN3OS — CID 106366535
N-[2-(bromomethyl)cyclopentyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 106366535) has the molecular formula C10H14BrN3OS and a molecular weight of 304.21 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106366535 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NC1CCCC1CBr |
| InChI | InChI=1S/C10H14BrN3OS/c1-6-9(16-14-13-6)10(15)12-8-4-2-3-7(8)5-11/h7-8H,2-5H2,1H3,(H,12,15) |
| InChIKey | HQKYMBSOXBWANT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|