C13H20ClN3OS — CID 114179382
4-tert-butyl-N-[2-(chloromethyl)cyclopentyl]thiadiazole-5-carboxamide (PubChem CID 114179382) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(chloromethyl)cyclopentyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[2-(chloromethyl)cyclopentyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 114179382 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-tert-butyl-N-[2-(chloromethyl)cyclopentyl]thiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NC1CCCC1CCl |
| InChI | InChI=1S/C13H20ClN3OS/c1-13(2,3)11-10(19-17-16-11)12(18)15-9-6-4-5-8(9)7-14/h8-9H,4-7H2,1-3H3,(H,15,18) |
| InChIKey | YUMOQJKCZKZULA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|