C10H16N4OS — CID 65210234
N-(2-aminocyclopentyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 65210234) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(2-aminocyclopentyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65210234 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-(2-aminocyclopentyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NC1CCCC1N |
| InChI | InChI=1S/C10H16N4OS/c1-2-7-9(16-14-13-7)10(15)12-8-5-3-4-6(8)11/h6,8H,2-5,11H2,1H3,(H,12,15) |
| InChIKey | MOSXLOGCEZILPF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |