C17H17NO3 — CID 10636703
(1S,10R,11S,16R)-10,12-dimethoxy-15-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-14-one (PubChem CID 10636703) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1S,10R,11S,16R)-10,12-dimethoxy-15-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-14-one.
| Compound Name | (1S,10R,11S,16R)-10,12-dimethoxy-15-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-14-one |
|---|---|
| PubChem CID | 10636703 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (1S,10R,11S,16R)-10,12-dimethoxy-15-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-14-one |
| SMILES | COC1=CC(=O)N[C@H]2[C@@H]1[C@@]1(OC)C=Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C17H17NO3/c1-20-12-9-13(19)18-16-14-11-6-4-3-5-10(11)7-8-17(14,21-2)15(12)16/h3-9,14-16H,1-2H3,(H,18,19)/t14-,15+,16+,17+/m0/s1 |
| InChIKey | VEUNNQYCQXUIEE-YLFCFFPRSA-N |
| XLogP | 1.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |