C14H16N4O2 — CID 106369694
7-amino-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 106369694) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 7-amino-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-amino-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 106369694 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 7-amino-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cnc(CNc2cc3c(cc2N)NC(=O)CC3)o1 |
| InChI | InChI=1S/C14H16N4O2/c1-8-6-17-14(20-8)7-16-12-4-9-2-3-13(19)18-11(9)5-10(12)15/h4-6,16H,2-3,7,15H2,1H3,(H,18,19) |
| InChIKey | CGHFLXIAOCGVLB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|