C12H13N5O2 — CID 106393294
6-amino-7-(1,2,4-oxadiazol-3-ylmethylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 106393294) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 6-amino-7-(1,2,4-oxadiazol-3-ylmethylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-(1,2,4-oxadiazol-3-ylmethylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 106393294 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-amino-7-(1,2,4-oxadiazol-3-ylmethylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1cc2c(cc1NCc1ncon1)NC(=O)CC2 |
| InChI | InChI=1S/C12H13N5O2/c13-8-3-7-1-2-12(18)16-9(7)4-10(8)14-5-11-15-6-19-17-11/h3-4,6,14H,1-2,5,13H2,(H,16,18) |
| InChIKey | OOUDZFYDWKESSJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|