C13H14FN3O4 — CID 106374048
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-fluoro-5-methoxy-4-nitroaniline (PubChem CID 106374048) has the molecular formula C13H14FN3O4 and a molecular weight of 295.27 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-fluoro-5-methoxy-4-nitroaniline.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-fluoro-5-methoxy-4-nitroaniline |
|---|---|
| PubChem CID | 106374048 |
| Molecular Formula | C13H14FN3O4 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-fluoro-5-methoxy-4-nitroaniline |
| SMILES | COc1cc(NCc2nc(C)c(C)o2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14FN3O4/c1-7-8(2)21-13(16-7)6-15-10-5-12(20-3)11(17(18)19)4-9(10)14/h4-5,15H,6H2,1-3H3 |
| InChIKey | WLXIFVCTCOAESW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|