C14H15N3O3S — CID 106374767
5,6-dimethoxy-3-[(5-methyl-1,3-oxazol-2-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 106374767) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[(5-methyl-1,3-oxazol-2-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 5,6-dimethoxy-3-[(5-methyl-1,3-oxazol-2-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106374767 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5,6-dimethoxy-3-[(5-methyl-1,3-oxazol-2-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | COc1cc2[nH]c(=S)n(Cc3ncc(C)o3)c2cc1OC |
| InChI | InChI=1S/C14H15N3O3S/c1-8-6-15-13(20-8)7-17-10-5-12(19-3)11(18-2)4-9(10)16-14(17)21/h4-6H,7H2,1-3H3,(H,16,21) |
| InChIKey | WUIQKLCALIHTLG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|