C14H16N4O2S — CID 83006080
5,6-dimethoxy-3-[(1-methylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 83006080) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[(1-methylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 5,6-dimethoxy-3-[(1-methylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 83006080 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5,6-dimethoxy-3-[(1-methylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | COc1cc2[nH]c(=S)n(Cc3cnn(C)c3)c2cc1OC |
| InChI | InChI=1S/C14H16N4O2S/c1-17-7-9(6-15-17)8-18-11-5-13(20-3)12(19-2)4-10(11)16-14(18)21/h4-7H,8H2,1-3H3,(H,16,21) |
| InChIKey | PSJFAZILGLPILN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|