C12H13N5O2S — CID 106374810
9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-methoxy-7H-purine-8-thione (PubChem CID 106374810) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-methoxy-7H-purine-8-thione.
| Compound Name | 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-methoxy-7H-purine-8-thione |
|---|---|
| PubChem CID | 106374810 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-methoxy-7H-purine-8-thione |
| SMILES | COc1ncnc2c1[nH]c(=S)n2Cc1nc(C)c(C)o1 |
| InChI | InChI=1S/C12H13N5O2S/c1-6-7(2)19-8(15-6)4-17-10-9(16-12(17)20)11(18-3)14-5-13-10/h5H,4H2,1-3H3,(H,16,20) |
| InChIKey | ARQRFVXBVWMLJE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|