C13H10F2N4OS — CID 103586535
9-(2,5-difluoro-4-methylphenyl)-6-methoxy-7H-purine-8-thione (PubChem CID 103586535) has the molecular formula C13H10F2N4OS and a molecular weight of 308.31 g/mol. Its IUPAC name is 9-(2,5-difluoro-4-methylphenyl)-6-methoxy-7H-purine-8-thione.
| Compound Name | 9-(2,5-difluoro-4-methylphenyl)-6-methoxy-7H-purine-8-thione |
|---|---|
| PubChem CID | 103586535 |
| Molecular Formula | C13H10F2N4OS |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 9-(2,5-difluoro-4-methylphenyl)-6-methoxy-7H-purine-8-thione |
| SMILES | COc1ncnc2c1[nH]c(=S)n2-c1cc(F)c(C)cc1F |
| InChI | InChI=1S/C13H10F2N4OS/c1-6-3-8(15)9(4-7(6)14)19-11-10(18-13(19)21)12(20-2)17-5-16-11/h3-5H,1-2H3,(H,18,21) |
| InChIKey | LBCXVRIKUANNQQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|