C12H18N4OS — CID 113471841
6-methoxy-9-(2-methylpentan-2-yl)-7H-purine-8-thione (PubChem CID 113471841) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-methoxy-9-(2-methylpentan-2-yl)-7H-purine-8-thione.
| Compound Name | 6-methoxy-9-(2-methylpentan-2-yl)-7H-purine-8-thione |
|---|---|
| PubChem CID | 113471841 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-methoxy-9-(2-methylpentan-2-yl)-7H-purine-8-thione |
| SMILES | CCCC(C)(C)n1c(=S)[nH]c2c(OC)ncnc21 |
| InChI | InChI=1S/C12H18N4OS/c1-5-6-12(2,3)16-9-8(15-11(16)18)10(17-4)14-7-13-9/h7H,5-6H2,1-4H3,(H,15,18) |
| InChIKey | JQARGIQIQXTXDV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|