C7H11N3O2S — CID 106380776
3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide (PubChem CID 106380776) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide.
| Compound Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 106380776 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanamide |
| SMILES | NC(=O)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O2S/c8-6(11)1-2-9-3-5-4-13-7(12)10-5/h4,9H,1-3H2,(H2,8,11)(H,10,12) |
| InChIKey | ZJLHAKSLOJRDAZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|