C7H6F4N2O2S — CID 106383573
2,2,3,3-tetrafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 106383573) has the molecular formula C7H6F4N2O2S and a molecular weight of 258.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 106383573 |
| Molecular Formula | C7H6F4N2O2S |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | O=C(NCc1csc(=O)[nH]1)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H6F4N2O2S/c8-4(9)7(10,11)5(14)12-1-3-2-16-6(15)13-3/h2,4H,1H2,(H,12,14)(H,13,15) |
| InChIKey | CYTICFSXMDWGIP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|