C7H5F5N2O2S — CID 106383582
2,2,3,3,3-pentafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 106383582) has the molecular formula C7H5F5N2O2S and a molecular weight of 276.19 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 106383582 |
| Molecular Formula | C7H5F5N2O2S |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | O=C(NCc1csc(=O)[nH]1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F5N2O2S/c8-6(9,7(10,11)12)4(15)13-1-3-2-17-5(16)14-3/h2H,1H2,(H,13,15)(H,14,16) |
| InChIKey | NTHMWLSYZNZRNZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|