3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid

C7H10N2O3S — CID 106380874

IUPAC3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid
SMILESO=C(O)CCNCc1csc(=O)[nH]1
InChIInChI=1S/C7H10N2O3S/c10-6(11)1-2-8-3-5-4-13-7(12)9-5/h4,8H,1-3H2,(H,9,12)(H,10,11)
InChIKeyHBUXIAHSWPNVRE-UHFFFAOYSA-N
MW202.23 g/mol
LogP0.00
Rot. Bonds5

About 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid

3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid (PubChem CID 106380874) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid.

Molecular Properties

Compound Name3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid
PubChem CID106380874
Molecular FormulaC7H10N2O3S
Molecular Weight202.23 g/mol
Exact Mass202.04
IUPAC Name3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid
SMILESO=C(O)CCNCc1csc(=O)[nH]1
InChIInChI=1S/C7H10N2O3S/c10-6(11)1-2-8-3-5-4-13-7(12)9-5/h4,8H,1-3H2,(H,9,12)(H,10,11)
InChIKeyHBUXIAHSWPNVRE-UHFFFAOYSA-N
XLogP0.00
TPSA82.19 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.23
LogP ≤ 50.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid?
The IUPAC name of 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid (CID 106380874) is 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid.
What is the SMILES notation for 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid?
The canonical SMILES for 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid is O=C(O)CCNCc1csc(=O)[nH]1.
What is the InChIKey of 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid?
The InChIKey is HBUXIAHSWPNVRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3S/c10-6(11)1-2-8-3-5-4-13-7(12)9-5/h4,8H,1-3H2,(H,9,12)(H,10,11).
What are the key properties of 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid?
3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid has a molecular weight of 202.23 g/mol, XLogP of 0.00, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid is sourced from PubChem (CID 106380874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).