C7H10N2O3S — CID 106380874
3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid (PubChem CID 106380874) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid.
| Compound Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 106380874 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O3S/c10-6(11)1-2-8-3-5-4-13-7(12)9-5/h4,8H,1-3H2,(H,9,12)(H,10,11) |
| InChIKey | HBUXIAHSWPNVRE-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|