C10H14N2O3S — CID 106382353
methyl 2-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoate (PubChem CID 106382353) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is methyl 2-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoate.
| Compound Name | methyl 2-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoate |
|---|---|
| PubChem CID | 106382353 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl 2-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoate |
| SMILES | COC(=O)C(C)=CCNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H14N2O3S/c1-7(9(13)15-2)3-4-11-5-8-6-16-10(14)12-8/h3,6,11H,4-5H2,1-2H3,(H,12,14) |
| InChIKey | SQUAZBXGYSHCBD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|