C9H12N2O3S — CID 106382384
3-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid (PubChem CID 106382384) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid.
| Compound Name | 3-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106382384 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O3S/c1-6(2-8(12)13)3-10-4-7-5-15-9(14)11-7/h2,5,10H,3-4H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | POBOOFMOQPFJPY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|