C8H10N2O3S — CID 106382355
2-[[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]methyl]prop-2-enoic acid (PubChem CID 106382355) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-[[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106382355 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-[[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNCc1csc(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C8H10N2O3S/c1-5(7(11)12)2-9-3-6-4-14-8(13)10-6/h4,9H,1-3H2,(H,10,13)(H,11,12) |
| InChIKey | JAHSVBNPIKGTCD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|