C6H6N4OS2 — CID 106382427
4-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382427) has the molecular formula C6H6N4OS2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382427 |
| Molecular Formula | C6H6N4OS2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 4-[(5-sulfanylidene-1H-1,2,4-triazol-4-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(Cn2cn[nH]c2=S)cs1 |
| InChI | InChI=1S/C6H6N4OS2/c11-6-8-4(2-13-6)1-10-3-7-9-5(10)12/h2-3H,1H2,(H,8,11)(H,9,12) |
| InChIKey | KTHVCGWGOFLKDX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|