C13H14N4O3S — CID 106383084
2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide (PubChem CID 106383084) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide.
| Compound Name | 2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 106383084 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]acetamide |
| SMILES | N/C(=N/O)c1ccc(CC(=O)NCc2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H14N4O3S/c14-12(17-20)9-3-1-8(2-4-9)5-11(18)15-6-10-7-21-13(19)16-10/h1-4,7,20H,5-6H2,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | DLKVMSRPDUMHAY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|