About 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid
5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 106383569) has the molecular formula C8H7N3O3S2
and a molecular weight of 257.30 g/mol. Its IUPAC name is 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 106383569 |
| Molecular Formula | C8H7N3O3S2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H7N3O3S2/c12-7(13)5-6(16-3-10-5)9-1-4-2-15-8(14)11-4/h2-3,9H,1H2,(H,11,14)(H,12,13) |
| InChIKey | JATVNKWCXYXFBT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid (CID 106383569) is 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1NCc1csc(=O)[nH]1.
What is the InChIKey of 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is JATVNKWCXYXFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3S2/c12-7(13)5-6(16-3-10-5)9-1-4-2-15-8(14)11-4/h2-3,9H,1H2,(H,11,14)(H,12,13).
What are the key properties of 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid?
5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 257.30 g/mol, XLogP of 1.20, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106383569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).