C11H16N6OS — CID 106384287
4-[[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384287) has the molecular formula C11H16N6OS and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-[[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384287 |
| Molecular Formula | C11H16N6OS |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[[(6-hydrazinyl-2-propylpyrimidin-4-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCCc1nc(NN)cc(NCc2csc(=O)[nH]2)n1 |
| InChI | InChI=1S/C11H16N6OS/c1-2-3-8-15-9(4-10(16-8)17-12)13-5-7-6-19-11(18)14-7/h4,6H,2-3,5,12H2,1H3,(H,14,18)(H2,13,15,16,17) |
| InChIKey | IPYSSQILXUZNOR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|