C16H20O2S2 — CID 10638568
2-acetyl-4,4-bis(ethylsulfanyl)-2,3-dihydronaphthalen-1-one (PubChem CID 10638568) has the molecular formula C16H20O2S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-acetyl-4,4-bis(ethylsulfanyl)-2,3-dihydronaphthalen-1-one.
| Compound Name | 2-acetyl-4,4-bis(ethylsulfanyl)-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 10638568 |
| Molecular Formula | C16H20O2S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-acetyl-4,4-bis(ethylsulfanyl)-2,3-dihydronaphthalen-1-one |
| SMILES | CCSC1(SCC)CC(C(C)=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H20O2S2/c1-4-19-16(20-5-2)10-13(11(3)17)15(18)12-8-6-7-9-14(12)16/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | NMNGBAXFCHDISS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|