C17H22O3S2 — CID 10735771
methyl 4,4-bis(ethylsulfanyl)-3-methyl-1-oxo-2,3-dihydronaphthalene-2-carboxylate (PubChem CID 10735771) has the molecular formula C17H22O3S2 and a molecular weight of 338.49 g/mol. Its IUPAC name is methyl 4,4-bis(ethylsulfanyl)-3-methyl-1-oxo-2,3-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 4,4-bis(ethylsulfanyl)-3-methyl-1-oxo-2,3-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10735771 |
| Molecular Formula | C17H22O3S2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 4,4-bis(ethylsulfanyl)-3-methyl-1-oxo-2,3-dihydronaphthalene-2-carboxylate |
| SMILES | CCSC1(SCC)c2ccccc2C(=O)C(C(=O)OC)C1C |
| InChI | InChI=1S/C17H22O3S2/c1-5-21-17(22-6-2)11(3)14(16(19)20-4)15(18)12-9-7-8-10-13(12)17/h7-11,14H,5-6H2,1-4H3 |
| InChIKey | MEBDLKIOPNIUKY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|