C19H24N2O2 — CID 10638864
methyl (NE)-N-[phenyl-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methylidene]carbamate (PubChem CID 10638864) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (NE)-N-[phenyl-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methylidene]carbamate.
| Compound Name | methyl (NE)-N-[phenyl-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 10638864 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | methyl (NE)-N-[phenyl-[[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methylidene]carbamate |
| SMILES | COC(=O)/N=C(/N=C1/C(C)(C)[C@H]2CC[C@]1(C)C2)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c1-18(2)14-10-11-19(3,12-14)16(18)20-15(21-17(22)23-4)13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3/b20-16-,21-15+/t14-,19+/m0/s1 |
| InChIKey | GRXZCKCSQZCASC-NOTPUXPBSA-N |
| XLogP | 4.49 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|