C26H30N2O — CID 98789597
(1S)-2,2-diphenyl-N-[(E)-[(1R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclopropane-1-carboxamide (PubChem CID 98789597) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (1S)-2,2-diphenyl-N-[(E)-[(1R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-diphenyl-N-[(E)-[(1R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98789597 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (1S)-2,2-diphenyl-N-[(E)-[(1R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclopropane-1-carboxamide |
| SMILES | CC1(C)/C(=N/NC(=O)[C@H]2CC2(c2ccccc2)c2ccccc2)[C@]2(C)CC[C@@H]1C2 |
| InChI | InChI=1S/C26H30N2O/c1-24(2)20-14-15-25(3,16-20)23(24)28-27-22(29)21-17-26(21,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,20-21H,14-17H2,1-3H3,(H,27,29)/b28-23-/t20-,21-,25-/m1/s1 |
| InChIKey | OSRULRYXFGZPJZ-GLPLEDTMSA-N |
| XLogP | 5.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|