C19H22O4 — CID 50937914
(4-methoxycarbonylphenyl) (1S,4R)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 50937914) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) (1S,4R)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) (1S,4R)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 50937914 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (4-methoxycarbonylphenyl) (1S,4R)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@]1(C(=O)Oc1ccc(C(=O)OC)cc1)C2 |
| InChI | InChI=1S/C19H22O4/c1-12-18(2,3)14-9-10-19(12,11-14)17(21)23-15-7-5-13(6-8-15)16(20)22-4/h5-8,14H,1,9-11H2,2-4H3/t14-,19+/m1/s1 |
| InChIKey | WXZZJRGTZNMVNL-KUHUBIRLSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|