About propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate
propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate (PubChem CID 4861798) has the molecular formula C25H28O4
and a molecular weight of 392.50 g/mol. Its IUPAC name is propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate |
| PubChem CID | 4861798 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate |
| SMILES | C=C1C2(C(=O)Oc3c(C(=O)OCCC)ccc4ccccc34)CCC(C2)C1(C)C |
| InChI | InChI=1S/C25H28O4/c1-5-14-28-22(26)20-11-10-17-8-6-7-9-19(17)21(20)29-23(27)25-13-12-18(15-25)24(3,4)16(25)2/h6-11,18H,2,5,12-15H2,1,3-4H3 |
| InChIKey | WXXTWPARGFIDAD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
The IUPAC name of propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate (CID 4861798) is propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate.
What is the SMILES notation for propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
The canonical SMILES for propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate is C=C1C2(C(=O)Oc3c(C(=O)OCCC)ccc4ccccc34)CCC(C2)C1(C)C.
What is the InChIKey of propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
The InChIKey is WXXTWPARGFIDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28O4/c1-5-14-28-22(26)20-11-10-17-8-6-7-9-19(17)21(20)29-23(27)25-13-12-18(15-25)24(3,4)16(25)2/h6-11,18H,2,5,12-15H2,1,3-4H3.
What are the key properties of propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate has a molecular weight of 392.50 g/mol, XLogP of 5.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 1-(3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate is sourced from PubChem (CID 4861798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).