C18H21FN2O2 — CID 7364811
(1R,4R)-N'-(2-fluorobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 7364811) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is (1R,4R)-N'-(2-fluorobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | (1R,4R)-N'-(2-fluorobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 7364811 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (1R,4R)-N'-(2-fluorobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | C=C1C(C)(C)[C@@H]2CC[C@@]1(C(=O)NNC(=O)c1ccccc1F)C2 |
| InChI | InChI=1S/C18H21FN2O2/c1-11-17(2,3)12-8-9-18(11,10-12)16(23)21-20-15(22)13-6-4-5-7-14(13)19/h4-7,12H,1,8-10H2,2-3H3,(H,20,22)(H,21,23)/t12-,18-/m1/s1 |
| InChIKey | DQFDOGWOUFBTGD-KZULUSFZSA-N |
| XLogP | 2.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|