C18H21NO4 — CID 10639068
1-(1,3-benzodioxol-5-yloxy)-3-(benzylamino)butan-2-ol (PubChem CID 10639068) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yloxy)-3-(benzylamino)butan-2-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yloxy)-3-(benzylamino)butan-2-ol |
|---|---|
| PubChem CID | 10639068 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yloxy)-3-(benzylamino)butan-2-ol |
| SMILES | CC(NCc1ccccc1)C(O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21NO4/c1-13(19-10-14-5-3-2-4-6-14)16(20)11-21-15-7-8-17-18(9-15)23-12-22-17/h2-9,13,16,19-20H,10-12H2,1H3 |
| InChIKey | ZNJJKNOJAWTQCM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |