C20H19N3O — CID 10639199
(3Z)-3-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)-phenylmethylidene]isoindol-1-amine (PubChem CID 10639199) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (3Z)-3-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)-phenylmethylidene]isoindol-1-amine.
| Compound Name | (3Z)-3-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)-phenylmethylidene]isoindol-1-amine |
|---|---|
| PubChem CID | 10639199 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3Z)-3-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)-phenylmethylidene]isoindol-1-amine |
| SMILES | CC1(C)COC(/C(=C2\N=C(N)c3ccccc32)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H19N3O/c1-20(2)12-24-19(23-20)16(13-8-4-3-5-9-13)17-14-10-6-7-11-15(14)18(21)22-17/h3-11H,12H2,1-2H3,(H2,21,22)/b17-16- |
| InChIKey | HHMJXHZRZNVBAZ-MSUUIHNZSA-N |
| XLogP | 3.48 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|