2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid

C6H9N3O5S — CID 106395234

IUPAC2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid
SMILESO=C(O)CS(=O)(=O)NCCc1ncon1
InChIInChI=1S/C6H9N3O5S/c10-6(11)3-15(12,13)8-2-1-5-7-4-14-9-5/h4,8H,1-3H2,(H,10,11)
InChIKeyAVBWQVZGASWJGJ-UHFFFAOYSA-N
MW235.22 g/mol
LogP-1.38
Rot. Bonds6

About 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid

2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid (PubChem CID 106395234) has the molecular formula C6H9N3O5S and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid
PubChem CID106395234
Molecular FormulaC6H9N3O5S
Molecular Weight235.22 g/mol
Exact Mass235.03
IUPAC Name2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid
SMILESO=C(O)CS(=O)(=O)NCCc1ncon1
InChIInChI=1S/C6H9N3O5S/c10-6(11)3-15(12,13)8-2-1-5-7-4-14-9-5/h4,8H,1-3H2,(H,10,11)
InChIKeyAVBWQVZGASWJGJ-UHFFFAOYSA-N
XLogP-1.38
TPSA122.39 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.22
LogP ≤ 5-1.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid?
The IUPAC name of 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid (CID 106395234) is 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid.
What is the SMILES notation for 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid?
The canonical SMILES for 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid is O=C(O)CS(=O)(=O)NCCc1ncon1.
What is the InChIKey of 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid?
The InChIKey is AVBWQVZGASWJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O5S/c10-6(11)3-15(12,13)8-2-1-5-7-4-14-9-5/h4,8H,1-3H2,(H,10,11).
What are the key properties of 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid?
2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid has a molecular weight of 235.22 g/mol, XLogP of -1.38, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2,4-oxadiazol-3-yl)ethylsulfamoyl]acetic acid is sourced from PubChem (CID 106395234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).