C9H14ClN3O2 — CID 106395529
5-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pentanamide (PubChem CID 106395529) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 5-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pentanamide.
| Compound Name | 5-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 106395529 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pentanamide |
| SMILES | O=C(CCCCCl)NCCc1ncno1 |
| InChI | InChI=1S/C9H14ClN3O2/c10-5-2-1-3-8(14)11-6-4-9-12-7-13-15-9/h7H,1-6H2,(H,11,14) |
| InChIKey | BUGQTESKOVIQFU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|