C10H16N4O2 — CID 106397177
N-(1,2,4-oxadiazol-3-ylmethyl)-2-piperidin-3-ylacetamide (PubChem CID 106397177) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-2-piperidin-3-ylacetamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 106397177 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-piperidin-3-ylacetamide |
| SMILES | O=C(CC1CCCNC1)NCc1ncon1 |
| InChI | InChI=1S/C10H16N4O2/c15-10(4-8-2-1-3-11-5-8)12-6-9-13-7-16-14-9/h7-8,11H,1-6H2,(H,12,15) |
| InChIKey | NCCIMRJYUULDQO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |